C13H10N2 — CID 130570318
2-(3-methyl-2,3-dihydroinden-1-ylidene)propanedinitrile (PubChem CID 130570318) has the molecular formula C13H10N2 and a molecular weight of 194.24 g/mol. Its IUPAC name is 2-(3-methyl-2,3-dihydroinden-1-ylidene)propanedinitrile.
| Compound Name | 2-(3-methyl-2,3-dihydroinden-1-ylidene)propanedinitrile |
|---|---|
| PubChem CID | 130570318 |
| Molecular Formula | C13H10N2 |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 2-(3-methyl-2,3-dihydroinden-1-ylidene)propanedinitrile |
| SMILES | CC1CC(=C(C#N)C#N)c2ccccc21 |
| InChI | InChI=1S/C13H10N2/c1-9-6-13(10(7-14)8-15)12-5-3-2-4-11(9)12/h2-5,9H,6H2,1H3 |
| InChIKey | YTSSLXJLQSFBKM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|