C9H12N2O4 — CID 130571087
2-hydroxy-2-methyl-3-(3-methyl-2-oxopyrazin-1-yl)propanoic acid (PubChem CID 130571087) has the molecular formula C9H12N2O4 and a molecular weight of 212.21 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-3-(3-methyl-2-oxopyrazin-1-yl)propanoic acid.
| Compound Name | 2-hydroxy-2-methyl-3-(3-methyl-2-oxopyrazin-1-yl)propanoic acid |
|---|---|
| PubChem CID | 130571087 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2-hydroxy-2-methyl-3-(3-methyl-2-oxopyrazin-1-yl)propanoic acid |
| SMILES | Cc1nccn(CC(C)(O)C(=O)O)c1=O |
| InChI | InChI=1S/C9H12N2O4/c1-6-7(12)11(4-3-10-6)5-9(2,15)8(13)14/h3-4,15H,5H2,1-2H3,(H,13,14) |
| InChIKey | LIOZZVKNAZKXFY-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |