C9H10ClN3S — CID 130573212
2-(5-chlorothiophen-2-yl)-1-(1H-pyrazol-4-yl)ethanamine (PubChem CID 130573212) has the molecular formula C9H10ClN3S and a molecular weight of 227.72 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-1-(1H-pyrazol-4-yl)ethanamine.
| Compound Name | 2-(5-chlorothiophen-2-yl)-1-(1H-pyrazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 130573212 |
| Molecular Formula | C9H10ClN3S |
| Molecular Weight | 227.72 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-1-(1H-pyrazol-4-yl)ethanamine |
| SMILES | NC(Cc1ccc(Cl)s1)c1cn[nH]c1 |
| InChI | InChI=1S/C9H10ClN3S/c10-9-2-1-7(14-9)3-8(11)6-4-12-13-5-6/h1-2,4-5,8H,3,11H2,(H,12,13) |
| InChIKey | GBMDTXIWPDHLHN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.72 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |