C8H10N4S — CID 130573356
1-[2-(1H-pyrazol-4-yl)-1,3-thiazol-5-yl]ethanamine (PubChem CID 130573356) has the molecular formula C8H10N4S and a molecular weight of 194.26 g/mol. Its IUPAC name is 1-[2-(1H-pyrazol-4-yl)-1,3-thiazol-5-yl]ethanamine.
| Compound Name | 1-[2-(1H-pyrazol-4-yl)-1,3-thiazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 130573356 |
| Molecular Formula | C8H10N4S |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | 1-[2-(1H-pyrazol-4-yl)-1,3-thiazol-5-yl]ethanamine |
| SMILES | CC(N)c1cnc(-c2cn[nH]c2)s1 |
| InChI | InChI=1S/C8H10N4S/c1-5(9)7-4-10-8(13-7)6-2-11-12-3-6/h2-5H,9H2,1H3,(H,11,12) |
| InChIKey | KJZDJJDGRIJWLH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |