About 1-(1,2,4-oxadiazol-3-ylmethyl)pyrazole-4-carbonitrile
1-(1,2,4-oxadiazol-3-ylmethyl)pyrazole-4-carbonitrile (PubChem CID 130573439) has the molecular formula C7H5N5O
and a molecular weight of 175.15 g/mol. Its IUPAC name is 1-(1,2,4-oxadiazol-3-ylmethyl)pyrazole-4-carbonitrile.
Analyze 1-(1,2,4-oxadiazol-3-ylmethyl)pyrazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2,4-oxadiazol-3-ylmethyl)pyrazole-4-carbonitrile?
The IUPAC name of 1-(1,2,4-oxadiazol-3-ylmethyl)pyrazole-4-carbonitrile (CID 130573439) is 1-(1,2,4-oxadiazol-3-ylmethyl)pyrazole-4-carbonitrile.
What is the SMILES notation for 1-(1,2,4-oxadiazol-3-ylmethyl)pyrazole-4-carbonitrile?
The canonical SMILES for 1-(1,2,4-oxadiazol-3-ylmethyl)pyrazole-4-carbonitrile is N#Cc1cnn(Cc2ncon2)c1.
What is the InChIKey of 1-(1,2,4-oxadiazol-3-ylmethyl)pyrazole-4-carbonitrile?
The InChIKey is INHJRNJNLAHQJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N5O/c8-1-6-2-10-12(3-6)4-7-9-5-13-11-7/h2-3,5H,4H2.
What are the key properties of 1-(1,2,4-oxadiazol-3-ylmethyl)pyrazole-4-carbonitrile?
1-(1,2,4-oxadiazol-3-ylmethyl)pyrazole-4-carbonitrile has a molecular weight of 175.15 g/mol, XLogP of 0.19, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2,4-oxadiazol-3-ylmethyl)pyrazole-4-carbonitrile is sourced from PubChem (CID 130573439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).