C11H17BrN2 — CID 130574098
3-N-(2-bromo-3-methylphenyl)butane-2,3-diamine (PubChem CID 130574098) has the molecular formula C11H17BrN2 and a molecular weight of 257.18 g/mol. Its IUPAC name is 3-N-(2-bromo-3-methylphenyl)butane-2,3-diamine.
| Compound Name | 3-N-(2-bromo-3-methylphenyl)butane-2,3-diamine |
|---|---|
| PubChem CID | 130574098 |
| Molecular Formula | C11H17BrN2 |
| Molecular Weight | 257.18 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 3-N-(2-bromo-3-methylphenyl)butane-2,3-diamine |
| SMILES | Cc1cccc(NC(C)C(C)N)c1Br |
| InChI | InChI=1S/C11H17BrN2/c1-7-5-4-6-10(11(7)12)14-9(3)8(2)13/h4-6,8-9,14H,13H2,1-3H3 |
| InChIKey | DPLVTCWGJWRKCS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.18 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |