C10H14BrN — CID 84792064
1-(3-bromo-2,4-dimethylphenyl)ethanamine (PubChem CID 84792064) has the molecular formula C10H14BrN and a molecular weight of 228.13 g/mol. Its IUPAC name is 1-(3-bromo-2,4-dimethylphenyl)ethanamine.
| Compound Name | 1-(3-bromo-2,4-dimethylphenyl)ethanamine |
|---|---|
| PubChem CID | 84792064 |
| Molecular Formula | C10H14BrN |
| Molecular Weight | 228.13 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 1-(3-bromo-2,4-dimethylphenyl)ethanamine |
| SMILES | Cc1ccc(C(C)N)c(C)c1Br |
| InChI | InChI=1S/C10H14BrN/c1-6-4-5-9(8(3)12)7(2)10(6)11/h4-5,8H,12H2,1-3H3 |
| InChIKey | LJRMKRJHMDQWAC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.13 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |