C12H6Cl3N3 — CID 13057542
2-anilino-3,5,6-trichloropyridine-4-carbonitrile (PubChem CID 13057542) has the molecular formula C12H6Cl3N3 and a molecular weight of 298.56 g/mol. Its IUPAC name is 2-anilino-3,5,6-trichloropyridine-4-carbonitrile.
| Compound Name | 2-anilino-3,5,6-trichloropyridine-4-carbonitrile |
|---|---|
| PubChem CID | 13057542 |
| Molecular Formula | C12H6Cl3N3 |
| Molecular Weight | 298.56 g/mol |
| Exact Mass | 296.96 |
| IUPAC Name | 2-anilino-3,5,6-trichloropyridine-4-carbonitrile |
| SMILES | N#Cc1c(Cl)c(Cl)nc(Nc2ccccc2)c1Cl |
| InChI | InChI=1S/C12H6Cl3N3/c13-9-8(6-16)10(14)12(18-11(9)15)17-7-4-2-1-3-5-7/h1-5H,(H,17,18) |
| InChIKey | LMAHRHSELZCAPO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.56 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|