C10H13BrN2O — CID 130577854
5-bromo-2-(methoxymethyl)-1,2,3,4-tetrahydroquinoxaline (PubChem CID 130577854) has the molecular formula C10H13BrN2O and a molecular weight of 257.13 g/mol. Its IUPAC name is 5-bromo-2-(methoxymethyl)-1,2,3,4-tetrahydroquinoxaline.
| Compound Name | 5-bromo-2-(methoxymethyl)-1,2,3,4-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 130577854 |
| Molecular Formula | C10H13BrN2O |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 5-bromo-2-(methoxymethyl)-1,2,3,4-tetrahydroquinoxaline |
| SMILES | COCC1CNc2c(Br)cccc2N1 |
| InChI | InChI=1S/C10H13BrN2O/c1-14-6-7-5-12-10-8(11)3-2-4-9(10)13-7/h2-4,7,12-13H,5-6H2,1H3 |
| InChIKey | WEAARZRYDSFCKF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |