C9H8BrF2N — CID 84706366
7-bromo-3-(difluoromethyl)-2,3-dihydro-1H-indole (PubChem CID 84706366) has the molecular formula C9H8BrF2N and a molecular weight of 248.07 g/mol. Its IUPAC name is 7-bromo-3-(difluoromethyl)-2,3-dihydro-1H-indole.
| Compound Name | 7-bromo-3-(difluoromethyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 84706366 |
| Molecular Formula | C9H8BrF2N |
| Molecular Weight | 248.07 g/mol |
| Exact Mass | 246.98 |
| IUPAC Name | 7-bromo-3-(difluoromethyl)-2,3-dihydro-1H-indole |
| SMILES | FC(F)C1CNc2c(Br)cccc21 |
| InChI | InChI=1S/C9H8BrF2N/c10-7-3-1-2-5-6(9(11)12)4-13-8(5)7/h1-3,6,9,13H,4H2 |
| InChIKey | FBHXUXIPADFISU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.07 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |