C9H16F2O — CID 130578356
1,1-difluoro-3-(1-methylcyclopentyl)propan-2-ol (PubChem CID 130578356) has the molecular formula C9H16F2O and a molecular weight of 178.22 g/mol. Its IUPAC name is 1,1-difluoro-3-(1-methylcyclopentyl)propan-2-ol.
| Compound Name | 1,1-difluoro-3-(1-methylcyclopentyl)propan-2-ol |
|---|---|
| PubChem CID | 130578356 |
| Molecular Formula | C9H16F2O |
| Molecular Weight | 178.22 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 1,1-difluoro-3-(1-methylcyclopentyl)propan-2-ol |
| SMILES | CC1(CC(O)C(F)F)CCCC1 |
| InChI | InChI=1S/C9H16F2O/c1-9(4-2-3-5-9)6-7(12)8(10)11/h7-8,12H,2-6H2,1H3 |
| InChIKey | YPCFXYJCORABIL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.22 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |