C9H17NO — CID 130579422
1-(2,3-dihydrofuran-4-yl)-3-methylbutan-1-amine (PubChem CID 130579422) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is 1-(2,3-dihydrofuran-4-yl)-3-methylbutan-1-amine.
| Compound Name | 1-(2,3-dihydrofuran-4-yl)-3-methylbutan-1-amine |
|---|---|
| PubChem CID | 130579422 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 1-(2,3-dihydrofuran-4-yl)-3-methylbutan-1-amine |
| SMILES | CC(C)CC(N)C1=COCC1 |
| InChI | InChI=1S/C9H17NO/c1-7(2)5-9(10)8-3-4-11-6-8/h6-7,9H,3-5,10H2,1-2H3 |
| InChIKey | QNWOFCVBTLEYHA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |