C10H17NO3 — CID 131081537
2,3-dihydrofuran-4-yl-(3-methoxyoxolan-3-yl)methanamine (PubChem CID 131081537) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is 2,3-dihydrofuran-4-yl-(3-methoxyoxolan-3-yl)methanamine.
| Compound Name | 2,3-dihydrofuran-4-yl-(3-methoxyoxolan-3-yl)methanamine |
|---|---|
| PubChem CID | 131081537 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 2,3-dihydrofuran-4-yl-(3-methoxyoxolan-3-yl)methanamine |
| SMILES | COC1(C(N)C2=COCC2)CCOC1 |
| InChI | InChI=1S/C10H17NO3/c1-12-10(3-5-14-7-10)9(11)8-2-4-13-6-8/h6,9H,2-5,7,11H2,1H3 |
| InChIKey | QUAWFLPZNDTNOR-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |