C16H27N — CID 28525663
(1S)-3-methyl-1-(2,3,4,5,6-pentamethylphenyl)butan-1-amine (PubChem CID 28525663) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is (1S)-3-methyl-1-(2,3,4,5,6-pentamethylphenyl)butan-1-amine.
| Compound Name | (1S)-3-methyl-1-(2,3,4,5,6-pentamethylphenyl)butan-1-amine |
|---|---|
| PubChem CID | 28525663 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | (1S)-3-methyl-1-(2,3,4,5,6-pentamethylphenyl)butan-1-amine |
| SMILES | Cc1c(C)c(C)c([C@@H](N)CC(C)C)c(C)c1C |
| InChI | InChI=1S/C16H27N/c1-9(2)8-15(17)16-13(6)11(4)10(3)12(5)14(16)7/h9,15H,8,17H2,1-7H3/t15-/m0/s1 |
| InChIKey | NVMJWXJRRBHDNN-HNNXBMFYSA-N |
| XLogP | 4.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |