C11H19NO — CID 130579517
2-(2,3-dihydrofuran-4-yl)-2-propylpyrrolidine (PubChem CID 130579517) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 2-(2,3-dihydrofuran-4-yl)-2-propylpyrrolidine.
| Compound Name | 2-(2,3-dihydrofuran-4-yl)-2-propylpyrrolidine |
|---|---|
| PubChem CID | 130579517 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 2-(2,3-dihydrofuran-4-yl)-2-propylpyrrolidine |
| SMILES | CCCC1(C2=COCC2)CCCN1 |
| InChI | InChI=1S/C11H19NO/c1-2-5-11(6-3-7-12-11)10-4-8-13-9-10/h9,12H,2-8H2,1H3 |
| InChIKey | HAVZSBWVHLXGPJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |