C11H16ClNOS — CID 130581494
N-tert-butyl-2-chloro-2-(2-methylthiophen-3-yl)acetamide (PubChem CID 130581494) has the molecular formula C11H16ClNOS and a molecular weight of 245.78 g/mol. Its IUPAC name is N-tert-butyl-2-chloro-2-(2-methylthiophen-3-yl)acetamide.
| Compound Name | N-tert-butyl-2-chloro-2-(2-methylthiophen-3-yl)acetamide |
|---|---|
| PubChem CID | 130581494 |
| Molecular Formula | C11H16ClNOS |
| Molecular Weight | 245.78 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | N-tert-butyl-2-chloro-2-(2-methylthiophen-3-yl)acetamide |
| SMILES | Cc1sccc1C(Cl)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C11H16ClNOS/c1-7-8(5-6-15-7)9(12)10(14)13-11(2,3)4/h5-6,9H,1-4H3,(H,13,14) |
| InChIKey | SLDULTQLMTZTIQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.78 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|