C10H17NOS — CID 130581723
3,3-dimethyl-1-[(E)-4-sulfanylbut-2-enyl]pyrrolidin-2-one (PubChem CID 130581723) has the molecular formula C10H17NOS and a molecular weight of 199.32 g/mol. Its IUPAC name is 3,3-dimethyl-1-[(E)-4-sulfanylbut-2-enyl]pyrrolidin-2-one.
| Compound Name | 3,3-dimethyl-1-[(E)-4-sulfanylbut-2-enyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 130581723 |
| Molecular Formula | C10H17NOS |
| Molecular Weight | 199.32 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 3,3-dimethyl-1-[(E)-4-sulfanylbut-2-enyl]pyrrolidin-2-one |
| SMILES | CC1(C)CCN(C/C=C/CS)C1=O |
| InChI | InChI=1S/C10H17NOS/c1-10(2)5-7-11(9(10)12)6-3-4-8-13/h3-4,13H,5-8H2,1-2H3/b4-3+ |
| InChIKey | MXQKNTXTVWFWCS-ONEGZZNKSA-N |
| XLogP | 1.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|