C11H20N2O — CID 130581774
N,N-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-6-carboxamide (PubChem CID 130581774) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is N,N-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-6-carboxamide.
| Compound Name | N,N-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 130581774 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | N,N-dimethyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-6-carboxamide |
| SMILES | CN(C)C(=O)C1CCC2CCNC2C1 |
| InChI | InChI=1S/C11H20N2O/c1-13(2)11(14)9-4-3-8-5-6-12-10(8)7-9/h8-10,12H,3-7H2,1-2H3 |
| InChIKey | HBERSHHORZMKKC-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |