C13H22N2O2 — CID 98532778
(1S,2S,3R,4S)-2-N,2-N,3-N,3-N-tetramethylbicyclo[2.2.1]heptane-2,3-dicarboxamide (PubChem CID 98532778) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is (1S,2S,3R,4S)-2-N,2-N,3-N,3-N-tetramethylbicyclo[2.2.1]heptane-2,3-dicarboxamide.
| Compound Name | (1S,2S,3R,4S)-2-N,2-N,3-N,3-N-tetramethylbicyclo[2.2.1]heptane-2,3-dicarboxamide |
|---|---|
| PubChem CID | 98532778 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | (1S,2S,3R,4S)-2-N,2-N,3-N,3-N-tetramethylbicyclo[2.2.1]heptane-2,3-dicarboxamide |
| SMILES | CN(C)C(=O)[C@@H]1[C@H]2CC[C@@H](C2)[C@@H]1C(=O)N(C)C |
| InChI | InChI=1S/C13H22N2O2/c1-14(2)12(16)10-8-5-6-9(7-8)11(10)13(17)15(3)4/h8-11H,5-7H2,1-4H3/t8-,9-,10-,11+/m0/s1 |
| InChIKey | CFUWEHCLGQGUFT-XWLWVQCSSA-N |
| XLogP | 0.83 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |