C8H6ClFN2S2 — CID 130594459
2-(1-chloroethyl)-5-(3-fluorothiophen-2-yl)-1,3,4-thiadiazole (PubChem CID 130594459) has the molecular formula C8H6ClFN2S2 and a molecular weight of 248.74 g/mol. Its IUPAC name is 2-(1-chloroethyl)-5-(3-fluorothiophen-2-yl)-1,3,4-thiadiazole.
| Compound Name | 2-(1-chloroethyl)-5-(3-fluorothiophen-2-yl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 130594459 |
| Molecular Formula | C8H6ClFN2S2 |
| Molecular Weight | 248.74 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | 2-(1-chloroethyl)-5-(3-fluorothiophen-2-yl)-1,3,4-thiadiazole |
| SMILES | CC(Cl)c1nnc(-c2sccc2F)s1 |
| InChI | InChI=1S/C8H6ClFN2S2/c1-4(9)7-11-12-8(14-7)6-5(10)2-3-13-6/h2-4H,1H3 |
| InChIKey | FVTFBAFBSBEIAB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.74 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|