C9H10N2S2 — CID 130650382
2-propyl-5-thiophen-2-yl-1,3,4-thiadiazole (PubChem CID 130650382) has the molecular formula C9H10N2S2 and a molecular weight of 210.33 g/mol. Its IUPAC name is 2-propyl-5-thiophen-2-yl-1,3,4-thiadiazole.
| Compound Name | 2-propyl-5-thiophen-2-yl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 130650382 |
| Molecular Formula | C9H10N2S2 |
| Molecular Weight | 210.33 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | 2-propyl-5-thiophen-2-yl-1,3,4-thiadiazole |
| SMILES | CCCc1nnc(-c2cccs2)s1 |
| InChI | InChI=1S/C9H10N2S2/c1-2-4-8-10-11-9(13-8)7-5-3-6-12-7/h3,5-6H,2,4H2,1H3 |
| InChIKey | NUXXFRWGXVLCRE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |