C11H14F3NO2 — CID 130599420
1,1,1-trifluoro-2-methyl-3-(phenylmethoxyamino)propan-2-ol (PubChem CID 130599420) has the molecular formula C11H14F3NO2 and a molecular weight of 249.23 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-methyl-3-(phenylmethoxyamino)propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-methyl-3-(phenylmethoxyamino)propan-2-ol |
|---|---|
| PubChem CID | 130599420 |
| Molecular Formula | C11H14F3NO2 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 1,1,1-trifluoro-2-methyl-3-(phenylmethoxyamino)propan-2-ol |
| SMILES | CC(O)(CNOCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H14F3NO2/c1-10(16,11(12,13)14)8-15-17-7-9-5-3-2-4-6-9/h2-6,15-16H,7-8H2,1H3 |
| InChIKey | GCQRIKWUEVGZOK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|