C10H7ClN2 — CID 130603895
6-chloro-3-ethynyl-8-methylimidazo[1,2-a]pyridine (PubChem CID 130603895) has the molecular formula C10H7ClN2 and a molecular weight of 190.63 g/mol. Its IUPAC name is 6-chloro-3-ethynyl-8-methylimidazo[1,2-a]pyridine.
| Compound Name | 6-chloro-3-ethynyl-8-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 130603895 |
| Molecular Formula | C10H7ClN2 |
| Molecular Weight | 190.63 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | 6-chloro-3-ethynyl-8-methylimidazo[1,2-a]pyridine |
| SMILES | C#Cc1cnc2c(C)cc(Cl)cn12 |
| InChI | InChI=1S/C10H7ClN2/c1-3-9-5-12-10-7(2)4-8(11)6-13(9)10/h1,4-6H,2H3 |
| InChIKey | ZUHRYBYKVBYNIT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.63 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|