C8H6Cl2N2O — CID 82069651
(6,8-dichloroimidazo[1,2-a]pyridin-3-yl)methanol (PubChem CID 82069651) has the molecular formula C8H6Cl2N2O and a molecular weight of 217.06 g/mol. Its IUPAC name is (6,8-dichloroimidazo[1,2-a]pyridin-3-yl)methanol.
| Compound Name | (6,8-dichloroimidazo[1,2-a]pyridin-3-yl)methanol |
|---|---|
| PubChem CID | 82069651 |
| Molecular Formula | C8H6Cl2N2O |
| Molecular Weight | 217.06 g/mol |
| Exact Mass | 215.99 |
| IUPAC Name | (6,8-dichloroimidazo[1,2-a]pyridin-3-yl)methanol |
| SMILES | OCc1cnc2c(Cl)cc(Cl)cn12 |
| InChI | InChI=1S/C8H6Cl2N2O/c9-5-1-7(10)8-11-2-6(4-13)12(8)3-5/h1-3,13H,4H2 |
| InChIKey | DVEDNRUVORQGEI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.06 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |