C9H7Cl2N3S — CID 82530701
2-(6,8-dichloroimidazo[1,2-a]pyridin-3-yl)ethanethioamide (PubChem CID 82530701) has the molecular formula C9H7Cl2N3S and a molecular weight of 260.15 g/mol. Its IUPAC name is 2-(6,8-dichloroimidazo[1,2-a]pyridin-3-yl)ethanethioamide.
| Compound Name | 2-(6,8-dichloroimidazo[1,2-a]pyridin-3-yl)ethanethioamide |
|---|---|
| PubChem CID | 82530701 |
| Molecular Formula | C9H7Cl2N3S |
| Molecular Weight | 260.15 g/mol |
| Exact Mass | 258.97 |
| IUPAC Name | 2-(6,8-dichloroimidazo[1,2-a]pyridin-3-yl)ethanethioamide |
| SMILES | NC(=S)Cc1cnc2c(Cl)cc(Cl)cn12 |
| InChI | InChI=1S/C9H7Cl2N3S/c10-5-1-7(11)9-13-3-6(2-8(12)15)14(9)4-5/h1,3-4H,2H2,(H2,12,15) |
| InChIKey | VELIYHHDYSUBKV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.15 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|