C8H7ClN4S — CID 82151278
2-(6-chloroimidazo[4,5-b]pyridin-3-yl)ethanethioamide (PubChem CID 82151278) has the molecular formula C8H7ClN4S and a molecular weight of 226.69 g/mol. Its IUPAC name is 2-(6-chloroimidazo[4,5-b]pyridin-3-yl)ethanethioamide.
| Compound Name | 2-(6-chloroimidazo[4,5-b]pyridin-3-yl)ethanethioamide |
|---|---|
| PubChem CID | 82151278 |
| Molecular Formula | C8H7ClN4S |
| Molecular Weight | 226.69 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 2-(6-chloroimidazo[4,5-b]pyridin-3-yl)ethanethioamide |
| SMILES | NC(=S)Cn1cnc2cc(Cl)cnc21 |
| InChI | InChI=1S/C8H7ClN4S/c9-5-1-6-8(11-2-5)13(4-12-6)3-7(10)14/h1-2,4H,3H2,(H2,10,14) |
| InChIKey | MJOAOWXWHUYPQP-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.69 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|