About 1-(6-chloroimidazo[4,5-b]pyridin-3-yl)butan-2-amine
1-(6-chloroimidazo[4,5-b]pyridin-3-yl)butan-2-amine (PubChem CID 82144061) has the molecular formula C10H13ClN4
and a molecular weight of 224.69 g/mol. Its IUPAC name is 1-(6-chloroimidazo[4,5-b]pyridin-3-yl)butan-2-amine.
Molecular Properties
| Compound Name | 1-(6-chloroimidazo[4,5-b]pyridin-3-yl)butan-2-amine |
| PubChem CID | 82144061 |
| Molecular Formula | C10H13ClN4 |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 1-(6-chloroimidazo[4,5-b]pyridin-3-yl)butan-2-amine |
| SMILES | CCC(N)Cn1cnc2cc(Cl)cnc21 |
| InChI | InChI=1S/C10H13ClN4/c1-2-8(12)5-15-6-14-9-3-7(11)4-13-10(9)15/h3-4,6,8H,2,5,12H2,1H3 |
| InChIKey | ULKOQPPSYFTXAO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(6-chloroimidazo[4,5-b]pyridin-3-yl)butan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-chloroimidazo[4,5-b]pyridin-3-yl)butan-2-amine?
The IUPAC name of 1-(6-chloroimidazo[4,5-b]pyridin-3-yl)butan-2-amine (CID 82144061) is 1-(6-chloroimidazo[4,5-b]pyridin-3-yl)butan-2-amine.
What is the SMILES notation for 1-(6-chloroimidazo[4,5-b]pyridin-3-yl)butan-2-amine?
The canonical SMILES for 1-(6-chloroimidazo[4,5-b]pyridin-3-yl)butan-2-amine is CCC(N)Cn1cnc2cc(Cl)cnc21.
What is the InChIKey of 1-(6-chloroimidazo[4,5-b]pyridin-3-yl)butan-2-amine?
The InChIKey is ULKOQPPSYFTXAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClN4/c1-2-8(12)5-15-6-14-9-3-7(11)4-13-10(9)15/h3-4,6,8H,2,5,12H2,1H3.
What are the key properties of 1-(6-chloroimidazo[4,5-b]pyridin-3-yl)butan-2-amine?
1-(6-chloroimidazo[4,5-b]pyridin-3-yl)butan-2-amine has a molecular weight of 224.69 g/mol, XLogP of 1.82, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-chloroimidazo[4,5-b]pyridin-3-yl)butan-2-amine is sourced from PubChem (CID 82144061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).