C10H13ClN4 — CID 82144061
1-(6-chloroimidazo[4,5-b]pyridin-3-yl)butan-2-amine (PubChem CID 82144061) has the molecular formula C10H13ClN4 and a molecular weight of 224.69 g/mol. Its IUPAC name is 1-(6-chloroimidazo[4,5-b]pyridin-3-yl)butan-2-amine.
| Compound Name | 1-(6-chloroimidazo[4,5-b]pyridin-3-yl)butan-2-amine |
|---|---|
| PubChem CID | 82144061 |
| Molecular Formula | C10H13ClN4 |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 1-(6-chloroimidazo[4,5-b]pyridin-3-yl)butan-2-amine |
| SMILES | CCC(N)Cn1cnc2cc(Cl)cnc21 |
| InChI | InChI=1S/C10H13ClN4/c1-2-8(12)5-15-6-14-9-3-7(11)4-13-10(9)15/h3-4,6,8H,2,5,12H2,1H3 |
| InChIKey | ULKOQPPSYFTXAO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |