C12H23N3O2 — CID 130604565
tert-butyl N-[3-cyano-3-(ethylamino)-2-methylpropyl]carbamate (PubChem CID 130604565) has the molecular formula C12H23N3O2 and a molecular weight of 241.33 g/mol. Its IUPAC name is tert-butyl N-[3-cyano-3-(ethylamino)-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[3-cyano-3-(ethylamino)-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 130604565 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | tert-butyl N-[3-cyano-3-(ethylamino)-2-methylpropyl]carbamate |
| SMILES | CCNC(C#N)C(C)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H23N3O2/c1-6-14-10(7-13)9(2)8-15-11(16)17-12(3,4)5/h9-10,14H,6,8H2,1-5H3,(H,15,16) |
| InChIKey | CRPHALLTPUFYRU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |