C16H32N4O2 — CID 107443028
tert-butyl N-[2-[cyano-[2-(dimethylamino)ethylamino]methyl]-3-methylbutyl]carbamate (PubChem CID 107443028) has the molecular formula C16H32N4O2 and a molecular weight of 312.46 g/mol. Its IUPAC name is tert-butyl N-[2-[cyano-[2-(dimethylamino)ethylamino]methyl]-3-methylbutyl]carbamate.
| Compound Name | tert-butyl N-[2-[cyano-[2-(dimethylamino)ethylamino]methyl]-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 107443028 |
| Molecular Formula | C16H32N4O2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | tert-butyl N-[2-[cyano-[2-(dimethylamino)ethylamino]methyl]-3-methylbutyl]carbamate |
| SMILES | CC(C)C(CNC(=O)OC(C)(C)C)C(C#N)NCCN(C)C |
| InChI | InChI=1S/C16H32N4O2/c1-12(2)13(11-19-15(21)22-16(3,4)5)14(10-17)18-8-9-20(6)7/h12-14,18H,8-9,11H2,1-7H3,(H,19,21) |
| InChIKey | XJQFVZMRAMGFBI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |