C7H11NO3S2 — CID 130604877
2-methylsulfonyl-1-(3-methyl-1,2-thiazol-5-yl)ethanol (PubChem CID 130604877) has the molecular formula C7H11NO3S2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-methylsulfonyl-1-(3-methyl-1,2-thiazol-5-yl)ethanol.
| Compound Name | 2-methylsulfonyl-1-(3-methyl-1,2-thiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 130604877 |
| Molecular Formula | C7H11NO3S2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.02 |
| IUPAC Name | 2-methylsulfonyl-1-(3-methyl-1,2-thiazol-5-yl)ethanol |
| SMILES | Cc1cc(C(O)CS(C)(=O)=O)sn1 |
| InChI | InChI=1S/C7H11NO3S2/c1-5-3-7(12-8-5)6(9)4-13(2,10)11/h3,6,9H,4H2,1-2H3 |
| InChIKey | QHOPBBJYHDWOIP-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |