C6H9NOS — CID 45085688
1-(5-methyl-1,2-thiazol-3-yl)ethanol (PubChem CID 45085688) has the molecular formula C6H9NOS and a molecular weight of 143.21 g/mol. Its IUPAC name is 1-(5-methyl-1,2-thiazol-3-yl)ethanol.
| Compound Name | 1-(5-methyl-1,2-thiazol-3-yl)ethanol |
|---|---|
| PubChem CID | 45085688 |
| Molecular Formula | C6H9NOS |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.04 |
| IUPAC Name | 1-(5-methyl-1,2-thiazol-3-yl)ethanol |
| SMILES | Cc1cc(C(C)O)ns1 |
| InChI | InChI=1S/C6H9NOS/c1-4-3-6(5(2)8)7-9-4/h3,5,8H,1-2H3 |
| InChIKey | XWKHAAYNELHZCM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |