C5H7NOS — CID 14343601
(3-methyl-1,2-thiazol-5-yl)methanol (PubChem CID 14343601) has the molecular formula C5H7NOS and a molecular weight of 129.18 g/mol. Its IUPAC name is (3-methyl-1,2-thiazol-5-yl)methanol.
| Compound Name | (3-methyl-1,2-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 14343601 |
| Molecular Formula | C5H7NOS |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.02 |
| IUPAC Name | (3-methyl-1,2-thiazol-5-yl)methanol |
| SMILES | Cc1cc(CO)sn1 |
| InChI | InChI=1S/C5H7NOS/c1-4-2-5(3-7)8-6-4/h2,7H,3H2,1H3 |
| InChIKey | NAZIRNAGXQUADH-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |