About 2-methylsulfonyl-1-(1,2-thiazol-5-yl)propan-1-ol
2-methylsulfonyl-1-(1,2-thiazol-5-yl)propan-1-ol (PubChem CID 130952216) has the molecular formula C7H11NO3S2
and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-methylsulfonyl-1-(1,2-thiazol-5-yl)propan-1-ol.
Molecular Properties
| Compound Name | 2-methylsulfonyl-1-(1,2-thiazol-5-yl)propan-1-ol |
| PubChem CID | 130952216 |
| Molecular Formula | C7H11NO3S2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.02 |
| IUPAC Name | 2-methylsulfonyl-1-(1,2-thiazol-5-yl)propan-1-ol |
| SMILES | CC(C(O)c1ccns1)S(C)(=O)=O |
| InChI | InChI=1S/C7H11NO3S2/c1-5(13(2,10)11)7(9)6-3-4-8-12-6/h3-5,7,9H,1-2H3 |
| InChIKey | LQFRNNJMEJTZJU-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methylsulfonyl-1-(1,2-thiazol-5-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfonyl-1-(1,2-thiazol-5-yl)propan-1-ol?
The IUPAC name of 2-methylsulfonyl-1-(1,2-thiazol-5-yl)propan-1-ol (CID 130952216) is 2-methylsulfonyl-1-(1,2-thiazol-5-yl)propan-1-ol.
What is the SMILES notation for 2-methylsulfonyl-1-(1,2-thiazol-5-yl)propan-1-ol?
The canonical SMILES for 2-methylsulfonyl-1-(1,2-thiazol-5-yl)propan-1-ol is CC(C(O)c1ccns1)S(C)(=O)=O.
What is the InChIKey of 2-methylsulfonyl-1-(1,2-thiazol-5-yl)propan-1-ol?
The InChIKey is LQFRNNJMEJTZJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3S2/c1-5(13(2,10)11)7(9)6-3-4-8-12-6/h3-5,7,9H,1-2H3.
What are the key properties of 2-methylsulfonyl-1-(1,2-thiazol-5-yl)propan-1-ol?
2-methylsulfonyl-1-(1,2-thiazol-5-yl)propan-1-ol has a molecular weight of 221.30 g/mol, XLogP of 0.61, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfonyl-1-(1,2-thiazol-5-yl)propan-1-ol is sourced from PubChem (CID 130952216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).