C9H13NOS3 — CID 131081481
(3-methyl-1,4-dithian-2-yl)-(1,2-thiazol-5-yl)methanol (PubChem CID 131081481) has the molecular formula C9H13NOS3 and a molecular weight of 247.41 g/mol. Its IUPAC name is (3-methyl-1,4-dithian-2-yl)-(1,2-thiazol-5-yl)methanol.
| Compound Name | (3-methyl-1,4-dithian-2-yl)-(1,2-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 131081481 |
| Molecular Formula | C9H13NOS3 |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | (3-methyl-1,4-dithian-2-yl)-(1,2-thiazol-5-yl)methanol |
| SMILES | CC1SCCSC1C(O)c1ccns1 |
| InChI | InChI=1S/C9H13NOS3/c1-6-9(13-5-4-12-6)8(11)7-2-3-10-14-7/h2-3,6,8-9,11H,4-5H2,1H3 |
| InChIKey | LHNASBORVDNRTR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |