C9H13NOS — CID 130604889
cyclobutyl-(3-methyl-1,2-thiazol-5-yl)methanol (PubChem CID 130604889) has the molecular formula C9H13NOS and a molecular weight of 183.28 g/mol. Its IUPAC name is cyclobutyl-(3-methyl-1,2-thiazol-5-yl)methanol.
| Compound Name | cyclobutyl-(3-methyl-1,2-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 130604889 |
| Molecular Formula | C9H13NOS |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | cyclobutyl-(3-methyl-1,2-thiazol-5-yl)methanol |
| SMILES | Cc1cc(C(O)C2CCC2)sn1 |
| InChI | InChI=1S/C9H13NOS/c1-6-5-8(12-10-6)9(11)7-3-2-4-7/h5,7,9,11H,2-4H2,1H3 |
| InChIKey | LPXUPXKGUTWYGW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |