C7H13N3O3 — CID 130605339
1-methyl-3-[2-(1,2-oxazolidin-2-yl)-2-oxoethyl]urea (PubChem CID 130605339) has the molecular formula C7H13N3O3 and a molecular weight of 187.20 g/mol. Its IUPAC name is 1-methyl-3-[2-(1,2-oxazolidin-2-yl)-2-oxoethyl]urea.
| Compound Name | 1-methyl-3-[2-(1,2-oxazolidin-2-yl)-2-oxoethyl]urea |
|---|---|
| PubChem CID | 130605339 |
| Molecular Formula | C7H13N3O3 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 1-methyl-3-[2-(1,2-oxazolidin-2-yl)-2-oxoethyl]urea |
| SMILES | CNC(=O)NCC(=O)N1CCCO1 |
| InChI | InChI=1S/C7H13N3O3/c1-8-7(12)9-5-6(11)10-3-2-4-13-10/h2-5H2,1H3,(H2,8,9,12) |
| InChIKey | ATKYAHFAWMFXEF-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |