About 1-methyl-3-[2-(1,2-oxazolidin-2-yl)-2-oxoethyl]urea
1-methyl-3-[2-(1,2-oxazolidin-2-yl)-2-oxoethyl]urea (PubChem CID 130605339) has the molecular formula C7H13N3O3
and a molecular weight of 187.20 g/mol. Its IUPAC name is 1-methyl-3-[2-(1,2-oxazolidin-2-yl)-2-oxoethyl]urea.
Molecular Properties
| Compound Name | 1-methyl-3-[2-(1,2-oxazolidin-2-yl)-2-oxoethyl]urea |
| PubChem CID | 130605339 |
| Molecular Formula | C7H13N3O3 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 1-methyl-3-[2-(1,2-oxazolidin-2-yl)-2-oxoethyl]urea |
| SMILES | CNC(=O)NCC(=O)N1CCCO1 |
| InChI | InChI=1S/C7H13N3O3/c1-8-7(12)9-5-6(11)10-3-2-4-13-10/h2-5H2,1H3,(H2,8,9,12) |
| InChIKey | ATKYAHFAWMFXEF-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-3-[2-(1,2-oxazolidin-2-yl)-2-oxoethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-[2-(1,2-oxazolidin-2-yl)-2-oxoethyl]urea?
The IUPAC name of 1-methyl-3-[2-(1,2-oxazolidin-2-yl)-2-oxoethyl]urea (CID 130605339) is 1-methyl-3-[2-(1,2-oxazolidin-2-yl)-2-oxoethyl]urea.
What is the SMILES notation for 1-methyl-3-[2-(1,2-oxazolidin-2-yl)-2-oxoethyl]urea?
The canonical SMILES for 1-methyl-3-[2-(1,2-oxazolidin-2-yl)-2-oxoethyl]urea is CNC(=O)NCC(=O)N1CCCO1.
What is the InChIKey of 1-methyl-3-[2-(1,2-oxazolidin-2-yl)-2-oxoethyl]urea?
The InChIKey is ATKYAHFAWMFXEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O3/c1-8-7(12)9-5-6(11)10-3-2-4-13-10/h2-5H2,1H3,(H2,8,9,12).
What are the key properties of 1-methyl-3-[2-(1,2-oxazolidin-2-yl)-2-oxoethyl]urea?
1-methyl-3-[2-(1,2-oxazolidin-2-yl)-2-oxoethyl]urea has a molecular weight of 187.20 g/mol, XLogP of -0.92, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-[2-(1,2-oxazolidin-2-yl)-2-oxoethyl]urea is sourced from PubChem (CID 130605339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).