C11H19NO2 — CID 14580111
2-cyclohexyl-1-(1,2-oxazolidin-2-yl)ethanone (PubChem CID 14580111) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-cyclohexyl-1-(1,2-oxazolidin-2-yl)ethanone.
| Compound Name | 2-cyclohexyl-1-(1,2-oxazolidin-2-yl)ethanone |
|---|---|
| PubChem CID | 14580111 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 2-cyclohexyl-1-(1,2-oxazolidin-2-yl)ethanone |
| SMILES | O=C(CC1CCCCC1)N1CCCO1 |
| InChI | InChI=1S/C11H19NO2/c13-11(12-7-4-8-14-12)9-10-5-2-1-3-6-10/h10H,1-9H2 |
| InChIKey | IYCVZMIQLLZDDD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |