C18H30N2O3 — CID 97364777
2-[(3aR,7S,7aS)-2-cyclopentyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-(oxazinan-2-yl)ethanone (PubChem CID 97364777) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is 2-[(3aR,7S,7aS)-2-cyclopentyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-(oxazinan-2-yl)ethanone.
| Compound Name | 2-[(3aR,7S,7aS)-2-cyclopentyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-(oxazinan-2-yl)ethanone |
|---|---|
| PubChem CID | 97364777 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 2-[(3aR,7S,7aS)-2-cyclopentyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-(oxazinan-2-yl)ethanone |
| SMILES | O=C(C[C@@H]1COC[C@H]2CN(C3CCCC3)C[C@@H]12)N1CCCCO1 |
| InChI | InChI=1S/C18H30N2O3/c21-18(20-7-3-4-8-23-20)9-14-12-22-13-15-10-19(11-17(14)15)16-5-1-2-6-16/h14-17H,1-13H2/t14-,15-,17+/m1/s1 |
| InChIKey | PZFLWZLUUUAOHE-INMHGKMJSA-N |
| XLogP | 2.07 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |