C19H29F3N2O5 — CID 155848712
2-[(3aR,7S,7aS)-2-cyclobutyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-(oxazinan-2-yl)ethanone;2,2,2-trifluoroacetic acid (PubChem CID 155848712) has the molecular formula C19H29F3N2O5 and a molecular weight of 422.44 g/mol. Its IUPAC name is 2-[(3aR,7S,7aS)-2-cyclobutyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-(oxazinan-2-yl)ethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(3aR,7S,7aS)-2-cyclobutyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-(oxazinan-2-yl)ethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155848712 |
| Molecular Formula | C19H29F3N2O5 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 2-[(3aR,7S,7aS)-2-cyclobutyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-(oxazinan-2-yl)ethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(C[C@@H]1COC[C@H]2CN(C3CCC3)C[C@@H]12)N1CCCCO1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H28N2O3.C2HF3O2/c20-17(19-6-1-2-7-22-19)8-13-11-21-12-14-9-18(10-16(13)14)15-4-3-5-15;3-2(4,5)1(6)7/h13-16H,1-12H2;(H,6,7)/t13-,14-,16+;/m1./s1 |
| InChIKey | KIGPNWHYCFUSQS-ISNMTSCSSA-N |
| XLogP | 2.31 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |