C16H27N3O3 — CID 97379939
(3aR,7S,7aS)-N,N-dimethyl-7-(2-oxo-2-pyrrolidin-1-ylethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-2-carboxamide (PubChem CID 97379939) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is (3aR,7S,7aS)-N,N-dimethyl-7-(2-oxo-2-pyrrolidin-1-ylethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-2-carboxamide.
| Compound Name | (3aR,7S,7aS)-N,N-dimethyl-7-(2-oxo-2-pyrrolidin-1-ylethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 97379939 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (3aR,7S,7aS)-N,N-dimethyl-7-(2-oxo-2-pyrrolidin-1-ylethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole-2-carboxamide |
| SMILES | CN(C)C(=O)N1C[C@@H]2COC[C@@H](CC(=O)N3CCCC3)[C@@H]2C1 |
| InChI | InChI=1S/C16H27N3O3/c1-17(2)16(21)19-8-13-11-22-10-12(14(13)9-19)7-15(20)18-5-3-4-6-18/h12-14H,3-11H2,1-2H3/t12-,13-,14+/m1/s1 |
| InChIKey | NMPIVJDKYDCMJV-MCIONIFRSA-N |
| XLogP | 0.87 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |