C18H24N2O5 — CID 97379953
2-[(3aR,7S,7aS)-2-(furan-3-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-morpholin-4-ylethanone (PubChem CID 97379953) has the molecular formula C18H24N2O5 and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-[(3aR,7S,7aS)-2-(furan-3-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[(3aR,7S,7aS)-2-(furan-3-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 97379953 |
| Molecular Formula | C18H24N2O5 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-[(3aR,7S,7aS)-2-(furan-3-carbonyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrol-7-yl]-1-morpholin-4-ylethanone |
| SMILES | O=C(C[C@@H]1COC[C@H]2CN(C(=O)c3ccoc3)C[C@@H]12)N1CCOCC1 |
| InChI | InChI=1S/C18H24N2O5/c21-17(19-2-5-23-6-3-19)7-14-11-25-12-15-8-20(9-16(14)15)18(22)13-1-4-24-10-13/h1,4,10,14-16H,2-3,5-9,11-12H2/t14-,15-,16+/m1/s1 |
| InChIKey | YFVXZABGUGQGJP-OAGGEKHMSA-N |
| XLogP | 0.86 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |