About 1-N-(3,5-dibromo-4-pyridinyl)-2-methylpropane-1,2-diamine
1-N-(3,5-dibromo-4-pyridinyl)-2-methylpropane-1,2-diamine (PubChem CID 130608023) has the molecular formula C9H13Br2N3
and a molecular weight of 323.03 g/mol. Its IUPAC name is 1-N-(3,5-dibromo-4-pyridinyl)-2-methylpropane-1,2-diamine.
Molecular Properties
| Compound Name | 1-N-(3,5-dibromo-4-pyridinyl)-2-methylpropane-1,2-diamine |
| PubChem CID | 130608023 |
| Molecular Formula | C9H13Br2N3 |
| Molecular Weight | 323.03 g/mol |
| Exact Mass | 320.95 |
| IUPAC Name | 1-N-(3,5-dibromo-4-pyridinyl)-2-methylpropane-1,2-diamine |
| SMILES | CC(C)(N)CNc1c(Br)cncc1Br |
| InChI | InChI=1S/C9H13Br2N3/c1-9(2,12)5-14-8-6(10)3-13-4-7(8)11/h3-4H,5,12H2,1-2H3,(H,13,14) |
| InChIKey | KTIOMYMFEMBFIS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.03 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-N-(3,5-dibromo-4-pyridinyl)-2-methylpropane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(3,5-dibromo-4-pyridinyl)-2-methylpropane-1,2-diamine?
The IUPAC name of 1-N-(3,5-dibromo-4-pyridinyl)-2-methylpropane-1,2-diamine (CID 130608023) is 1-N-(3,5-dibromo-4-pyridinyl)-2-methylpropane-1,2-diamine.
What is the SMILES notation for 1-N-(3,5-dibromo-4-pyridinyl)-2-methylpropane-1,2-diamine?
The canonical SMILES for 1-N-(3,5-dibromo-4-pyridinyl)-2-methylpropane-1,2-diamine is CC(C)(N)CNc1c(Br)cncc1Br.
What is the InChIKey of 1-N-(3,5-dibromo-4-pyridinyl)-2-methylpropane-1,2-diamine?
The InChIKey is KTIOMYMFEMBFIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13Br2N3/c1-9(2,12)5-14-8-6(10)3-13-4-7(8)11/h3-4H,5,12H2,1-2H3,(H,13,14).
What are the key properties of 1-N-(3,5-dibromo-4-pyridinyl)-2-methylpropane-1,2-diamine?
1-N-(3,5-dibromo-4-pyridinyl)-2-methylpropane-1,2-diamine has a molecular weight of 323.03 g/mol, XLogP of 2.76, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(3,5-dibromo-4-pyridinyl)-2-methylpropane-1,2-diamine is sourced from PubChem (CID 130608023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).