C10H17NO — CID 130608522
[(1R,2R)-2-(prop-2-ynylamino)cyclohexyl]methanol (PubChem CID 130608522) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is [(1R,2R)-2-(prop-2-ynylamino)cyclohexyl]methanol.
| Compound Name | [(1R,2R)-2-(prop-2-ynylamino)cyclohexyl]methanol |
|---|---|
| PubChem CID | 130608522 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | [(1R,2R)-2-(prop-2-ynylamino)cyclohexyl]methanol |
| SMILES | C#CCN[C@@H]1CCCC[C@H]1CO |
| InChI | InChI=1S/C10H17NO/c1-2-7-11-10-6-4-3-5-9(10)8-12/h1,9-12H,3-8H2/t9-,10+/m0/s1 |
| InChIKey | YNRTWQAQHVACLB-VHSXEESVSA-N |
| XLogP | 0.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|