C10H15NO2 — CID 103860466
N-[2-(hydroxymethyl)cyclohexyl]prop-2-ynamide (PubChem CID 103860466) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is N-[2-(hydroxymethyl)cyclohexyl]prop-2-ynamide.
| Compound Name | N-[2-(hydroxymethyl)cyclohexyl]prop-2-ynamide |
|---|---|
| PubChem CID | 103860466 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | N-[2-(hydroxymethyl)cyclohexyl]prop-2-ynamide |
| SMILES | C#CC(=O)NC1CCCCC1CO |
| InChI | InChI=1S/C10H15NO2/c1-2-10(13)11-9-6-4-3-5-8(9)7-12/h1,8-9,12H,3-7H2,(H,11,13) |
| InChIKey | VPYYKKZLFHERIP-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|