C5HCl2F3N2O — CID 130608876
4,5-dichloro-2-(trifluoromethyl)pyridazin-3-one (PubChem CID 130608876) has the molecular formula C5HCl2F3N2O and a molecular weight of 232.98 g/mol. Its IUPAC name is 4,5-dichloro-2-(trifluoromethyl)pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-(trifluoromethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 130608876 |
| Molecular Formula | C5HCl2F3N2O |
| Molecular Weight | 232.98 g/mol |
| Exact Mass | 231.94 |
| IUPAC Name | 4,5-dichloro-2-(trifluoromethyl)pyridazin-3-one |
| SMILES | O=c1c(Cl)c(Cl)cnn1C(F)(F)F |
| InChI | InChI=1S/C5HCl2F3N2O/c6-2-1-11-12(5(8,9)10)4(13)3(2)7/h1H |
| InChIKey | KLLVCWSTEZCWIO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.98 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |