C10H17NO3 — CID 130609525
N-(oxetan-3-yl)-1,4-dioxaspiro[4.4]nonan-8-amine (PubChem CID 130609525) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is N-(oxetan-3-yl)-1,4-dioxaspiro[4.4]nonan-8-amine.
| Compound Name | N-(oxetan-3-yl)-1,4-dioxaspiro[4.4]nonan-8-amine |
|---|---|
| PubChem CID | 130609525 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | N-(oxetan-3-yl)-1,4-dioxaspiro[4.4]nonan-8-amine |
| SMILES | C1COC2(CCC(NC3COC3)C2)O1 |
| InChI | InChI=1S/C10H17NO3/c1-2-10(13-3-4-14-10)5-8(1)11-9-6-12-7-9/h8-9,11H,1-7H2 |
| InChIKey | BPFKAMBGFSVKLB-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |