C11H17NO4 — CID 131160483
3-(1,4-dioxaspiro[4.4]nonan-8-ylamino)oxolan-2-one (PubChem CID 131160483) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is 3-(1,4-dioxaspiro[4.4]nonan-8-ylamino)oxolan-2-one.
| Compound Name | 3-(1,4-dioxaspiro[4.4]nonan-8-ylamino)oxolan-2-one |
|---|---|
| PubChem CID | 131160483 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 3-(1,4-dioxaspiro[4.4]nonan-8-ylamino)oxolan-2-one |
| SMILES | O=C1OCCC1NC1CCC2(C1)OCCO2 |
| InChI | InChI=1S/C11H17NO4/c13-10-9(2-4-14-10)12-8-1-3-11(7-8)15-5-6-16-11/h8-9,12H,1-7H2 |
| InChIKey | NTBXWFQMESDNON-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |