C7H12N4O2 — CID 130610404
(1,5-dimethylpyrazol-3-yl)methoxyurea (PubChem CID 130610404) has the molecular formula C7H12N4O2 and a molecular weight of 184.20 g/mol. Its IUPAC name is (1,5-dimethylpyrazol-3-yl)methoxyurea.
| Compound Name | (1,5-dimethylpyrazol-3-yl)methoxyurea |
|---|---|
| PubChem CID | 130610404 |
| Molecular Formula | C7H12N4O2 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | (1,5-dimethylpyrazol-3-yl)methoxyurea |
| SMILES | Cc1cc(CONC(N)=O)nn1C |
| InChI | InChI=1S/C7H12N4O2/c1-5-3-6(9-11(5)2)4-13-10-7(8)12/h3H,4H2,1-2H3,(H3,8,10,12) |
| InChIKey | KFVZKXIPGDSSNH-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|