C5H13ClN2O4S — CID 130610549
(3R,5S)-3,5-dihydroxypiperidine-1-sulfonamide;hydrochloride (PubChem CID 130610549) has the molecular formula C5H13ClN2O4S and a molecular weight of 232.69 g/mol. Its IUPAC name is (3R,5S)-3,5-dihydroxypiperidine-1-sulfonamide;hydrochloride.
| Compound Name | (3R,5S)-3,5-dihydroxypiperidine-1-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 130610549 |
| Molecular Formula | C5H13ClN2O4S |
| Molecular Weight | 232.69 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | (3R,5S)-3,5-dihydroxypiperidine-1-sulfonamide;hydrochloride |
| SMILES | Cl.NS(=O)(=O)N1C[C@H](O)C[C@H](O)C1 |
| InChI | InChI=1S/C5H12N2O4S.ClH/c6-12(10,11)7-2-4(8)1-5(9)3-7;/h4-5,8-9H,1-3H2,(H2,6,10,11);1H/t4-,5+; |
| InChIKey | CQGBPJZLAOOSAW-JEVYUYNZSA-N |
| XLogP | -1.96 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.69 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |