C10H15NO2 — CID 130613652
N-cyclobutyl-N-methyl-2,3-dihydrofuran-5-carboxamide (PubChem CID 130613652) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is N-cyclobutyl-N-methyl-2,3-dihydrofuran-5-carboxamide.
| Compound Name | N-cyclobutyl-N-methyl-2,3-dihydrofuran-5-carboxamide |
|---|---|
| PubChem CID | 130613652 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | N-cyclobutyl-N-methyl-2,3-dihydrofuran-5-carboxamide |
| SMILES | CN(C(=O)C1=CCCO1)C1CCC1 |
| InChI | InChI=1S/C10H15NO2/c1-11(8-4-2-5-8)10(12)9-6-3-7-13-9/h6,8H,2-5,7H2,1H3 |
| InChIKey | PIIQIVCMNDRYLW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |